C18H23NO5 — CID 146099557
methyl (E)-4-[[4-(2-methoxyphenyl)oxan-4-yl]methylamino]-4-oxobut-2-enoate (PubChem CID 146099557) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is methyl (E)-4-[[4-(2-methoxyphenyl)oxan-4-yl]methylamino]-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-[[4-(2-methoxyphenyl)oxan-4-yl]methylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 146099557 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | methyl (E)-4-[[4-(2-methoxyphenyl)oxan-4-yl]methylamino]-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)NCC1(c2ccccc2OC)CCOCC1 |
| InChI | InChI=1S/C18H23NO5/c1-22-15-6-4-3-5-14(15)18(9-11-24-12-10-18)13-19-16(20)7-8-17(21)23-2/h3-8H,9-13H2,1-2H3,(H,19,20)/b8-7+ |
| InChIKey | OZIVVXSYWWPNDT-BQYQJAHWSA-N |
| XLogP | 1.59 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|