C15H17N3O4S — CID 146099824
methyl (E)-5-[(2,5-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carbonyl)amino]pent-2-enoate (PubChem CID 146099824) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is methyl (E)-5-[(2,5-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carbonyl)amino]pent-2-enoate.
| Compound Name | methyl (E)-5-[(2,5-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carbonyl)amino]pent-2-enoate |
|---|---|
| PubChem CID | 146099824 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | methyl (E)-5-[(2,5-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carbonyl)amino]pent-2-enoate |
| SMILES | COC(=O)/C=C/CCNC(=O)c1sc2nc(C)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C15H17N3O4S/c1-8-11-13(20)17-9(2)18-15(11)23-12(8)14(21)16-7-5-4-6-10(19)22-3/h4,6H,5,7H2,1-3H3,(H,16,21)(H,17,18,20)/b6-4+ |
| InChIKey | CTAZTMCPIZETFA-GQCTYLIASA-N |
| XLogP | 1.45 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|