C18H22N2O4 — CID 146099845
methyl (E)-5-[(1-benzyl-5-oxopyrrolidine-3-carbonyl)amino]pent-2-enoate (PubChem CID 146099845) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is methyl (E)-5-[(1-benzyl-5-oxopyrrolidine-3-carbonyl)amino]pent-2-enoate.
| Compound Name | methyl (E)-5-[(1-benzyl-5-oxopyrrolidine-3-carbonyl)amino]pent-2-enoate |
|---|---|
| PubChem CID | 146099845 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | methyl (E)-5-[(1-benzyl-5-oxopyrrolidine-3-carbonyl)amino]pent-2-enoate |
| SMILES | COC(=O)/C=C/CCNC(=O)C1CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H22N2O4/c1-24-17(22)9-5-6-10-19-18(23)15-11-16(21)20(13-15)12-14-7-3-2-4-8-14/h2-5,7-9,15H,6,10-13H2,1H3,(H,19,23)/b9-5+ |
| InChIKey | JLRONHXSEOGKGQ-WEVVVXLNSA-N |
| XLogP | 1.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|