C15H21N3O4 — CID 146099949
methyl (E)-5-[[5-cyclopropyl-1-(2-hydroxyethyl)pyrazole-4-carbonyl]amino]pent-2-enoate (PubChem CID 146099949) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is methyl (E)-5-[[5-cyclopropyl-1-(2-hydroxyethyl)pyrazole-4-carbonyl]amino]pent-2-enoate.
| Compound Name | methyl (E)-5-[[5-cyclopropyl-1-(2-hydroxyethyl)pyrazole-4-carbonyl]amino]pent-2-enoate |
|---|---|
| PubChem CID | 146099949 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | methyl (E)-5-[[5-cyclopropyl-1-(2-hydroxyethyl)pyrazole-4-carbonyl]amino]pent-2-enoate |
| SMILES | COC(=O)/C=C/CCNC(=O)c1cnn(CCO)c1C1CC1 |
| InChI | InChI=1S/C15H21N3O4/c1-22-13(20)4-2-3-7-16-15(21)12-10-17-18(8-9-19)14(12)11-5-6-11/h2,4,10-11,19H,3,5-9H2,1H3,(H,16,21)/b4-2+ |
| InChIKey | AQDYBWPFEQTESM-DUXPYHPUSA-N |
| XLogP | 0.60 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|