C17H20N2O4 — CID 146100042
methyl (E)-5-[[2-(4-cyanophenoxy)-2-methylpropanoyl]amino]pent-2-enoate (PubChem CID 146100042) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is methyl (E)-5-[[2-(4-cyanophenoxy)-2-methylpropanoyl]amino]pent-2-enoate.
| Compound Name | methyl (E)-5-[[2-(4-cyanophenoxy)-2-methylpropanoyl]amino]pent-2-enoate |
|---|---|
| PubChem CID | 146100042 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | methyl (E)-5-[[2-(4-cyanophenoxy)-2-methylpropanoyl]amino]pent-2-enoate |
| SMILES | COC(=O)/C=C/CCNC(=O)C(C)(C)Oc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H20N2O4/c1-17(2,23-14-9-7-13(12-18)8-10-14)16(21)19-11-5-4-6-15(20)22-3/h4,6-10H,5,11H2,1-3H3,(H,19,21)/b6-4+ |
| InChIKey | DVZFMIGSJSYABC-GQCTYLIASA-N |
| XLogP | 1.95 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|