C15H19F3N6O2 — CID 146100238
(5S,7R)-2-ethyl-5,7-dimethyl-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide (PubChem CID 146100238) has the molecular formula C15H19F3N6O2 and a molecular weight of 372.35 g/mol. Its IUPAC name is (5S,7R)-2-ethyl-5,7-dimethyl-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide.
| Compound Name | (5S,7R)-2-ethyl-5,7-dimethyl-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146100238 |
| Molecular Formula | C15H19F3N6O2 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (5S,7R)-2-ethyl-5,7-dimethyl-N-[[3-(trifluoromethyl)-1H-1,2,4-triazol-5-yl]methyl]-5,7-dihydro-4H-pyrano[3,4-c]pyrazole-3-carboxamide |
| SMILES | CCn1nc2c(c1C(=O)NCc1nc(C(F)(F)F)n[nH]1)C[C@H](C)O[C@@H]2C |
| InChI | InChI=1S/C15H19F3N6O2/c1-4-24-12(9-5-7(2)26-8(3)11(9)23-24)13(25)19-6-10-20-14(22-21-10)15(16,17)18/h7-8H,4-6H2,1-3H3,(H,19,25)(H,20,21,22)/t7-,8+/m0/s1 |
| InChIKey | OHRGADPQOACEKO-JGVFFNPUSA-N |
| XLogP | 1.99 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |