C19H22N4O2 — CID 146101148
(5R,7S)-N-[(4-cyanophenyl)methyl]-N,1,5,7-tetramethyl-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146101148) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (5R,7S)-N-[(4-cyanophenyl)methyl]-N,1,5,7-tetramethyl-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-N-[(4-cyanophenyl)methyl]-N,1,5,7-tetramethyl-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146101148 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (5R,7S)-N-[(4-cyanophenyl)methyl]-N,1,5,7-tetramethyl-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(C(=O)N(C)Cc3ccc(C#N)cc3)nn(C)c2[C@H](C)O1 |
| InChI | InChI=1S/C19H22N4O2/c1-12-9-16-17(21-23(4)18(16)13(2)25-12)19(24)22(3)11-15-7-5-14(10-20)6-8-15/h5-8,12-13H,9,11H2,1-4H3/t12-,13+/m1/s1 |
| InChIKey | BAVLZXUQIAMNIV-OLZOCXBDSA-N |
| XLogP | 2.59 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |