About 7-phenyl-3H-azepine
7-phenyl-3H-azepine (PubChem CID 14610143) has the molecular formula C12H11N
and a molecular weight of 169.23 g/mol. Its IUPAC name is 7-phenyl-3H-azepine.
Molecular Properties
| Compound Name | 7-phenyl-3H-azepine |
| PubChem CID | 14610143 |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 7-phenyl-3H-azepine |
| SMILES | C1=CCC=NC(c2ccccc2)=C1 |
| InChI | InChI=1S/C12H11N/c1-3-7-11(8-4-1)12-9-5-2-6-10-13-12/h1-5,7-10H,6H2 |
| InChIKey | HMTLBCKIXVJAEZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-phenyl-3H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenyl-3H-azepine?
The IUPAC name of 7-phenyl-3H-azepine (CID 14610143) is 7-phenyl-3H-azepine.
What is the SMILES notation for 7-phenyl-3H-azepine?
The canonical SMILES for 7-phenyl-3H-azepine is C1=CCC=NC(c2ccccc2)=C1.
What is the InChIKey of 7-phenyl-3H-azepine?
The InChIKey is HMTLBCKIXVJAEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N/c1-3-7-11(8-4-1)12-9-5-2-6-10-13-12/h1-5,7-10H,6H2.
What are the key properties of 7-phenyl-3H-azepine?
7-phenyl-3H-azepine has a molecular weight of 169.23 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenyl-3H-azepine is sourced from PubChem (CID 14610143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).