C16H17F3N2O3 — CID 146101860
1-[[4-[3-hydroxy-3-(trifluoromethyl)azetidine-1-carbonyl]phenyl]methyl]pyrrolidin-2-one (PubChem CID 146101860) has the molecular formula C16H17F3N2O3 and a molecular weight of 342.32 g/mol. Its IUPAC name is 1-[[4-[3-hydroxy-3-(trifluoromethyl)azetidine-1-carbonyl]phenyl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[4-[3-hydroxy-3-(trifluoromethyl)azetidine-1-carbonyl]phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 146101860 |
| Molecular Formula | C16H17F3N2O3 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1-[[4-[3-hydroxy-3-(trifluoromethyl)azetidine-1-carbonyl]phenyl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1Cc1ccc(C(=O)N2CC(O)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C16H17F3N2O3/c17-16(18,19)15(24)9-21(10-15)14(23)12-5-3-11(4-6-12)8-20-7-1-2-13(20)22/h3-6,24H,1-2,7-10H2 |
| InChIKey | QHEKQDZPENSGRR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |