C11H13ClF6N2O2 — CID 146102052
N-[1-(2-chloropropanoyl)-6-(trifluoromethyl)piperidin-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 146102052) has the molecular formula C11H13ClF6N2O2 and a molecular weight of 354.68 g/mol. Its IUPAC name is N-[1-(2-chloropropanoyl)-6-(trifluoromethyl)piperidin-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-(2-chloropropanoyl)-6-(trifluoromethyl)piperidin-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 146102052 |
| Molecular Formula | C11H13ClF6N2O2 |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | N-[1-(2-chloropropanoyl)-6-(trifluoromethyl)piperidin-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC(Cl)C(=O)N1CC(NC(=O)C(F)(F)F)CCC1C(F)(F)F |
| InChI | InChI=1S/C11H13ClF6N2O2/c1-5(12)8(21)20-4-6(19-9(22)11(16,17)18)2-3-7(20)10(13,14)15/h5-7H,2-4H2,1H3,(H,19,22) |
| InChIKey | JRFKYJWQVXLLCA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|