C16H20FN3O3 — CID 146103364
7-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-2-hydroxy-5,7-diazaspiro[3.4]octane-6,8-dione (PubChem CID 146103364) has the molecular formula C16H20FN3O3 and a molecular weight of 321.35 g/mol. Its IUPAC name is 7-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-2-hydroxy-5,7-diazaspiro[3.4]octane-6,8-dione.
| Compound Name | 7-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-2-hydroxy-5,7-diazaspiro[3.4]octane-6,8-dione |
|---|---|
| PubChem CID | 146103364 |
| Molecular Formula | C16H20FN3O3 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 7-[2-[(4-fluorophenyl)methyl-methylamino]ethyl]-2-hydroxy-5,7-diazaspiro[3.4]octane-6,8-dione |
| SMILES | CN(CCN1C(=O)NC2(CC(O)C2)C1=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H20FN3O3/c1-19(10-11-2-4-12(17)5-3-11)6-7-20-14(22)16(18-15(20)23)8-13(21)9-16/h2-5,13,21H,6-10H2,1H3,(H,18,23) |
| InChIKey | LHWLHWZXDGDVRL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|