C10H17N3O3S2 — CID 146103570
1-ethyl-2-methyl-N-(1-oxothiolan-1-ylidene)imidazole-4-sulfonamide (PubChem CID 146103570) has the molecular formula C10H17N3O3S2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 1-ethyl-2-methyl-N-(1-oxothiolan-1-ylidene)imidazole-4-sulfonamide.
| Compound Name | 1-ethyl-2-methyl-N-(1-oxothiolan-1-ylidene)imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 146103570 |
| Molecular Formula | C10H17N3O3S2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 1-ethyl-2-methyl-N-(1-oxothiolan-1-ylidene)imidazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)N=S2(=O)CCCC2)nc1C |
| InChI | InChI=1S/C10H17N3O3S2/c1-3-13-8-10(11-9(13)2)18(15,16)12-17(14)6-4-5-7-17/h8H,3-7H2,1-2H3 |
| InChIKey | XYSNPYXFIYXSHJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |