C12H13BrClN3O — CID 146104514
2-[3-[(2-bromo-6-chlorophenyl)methylamino]pyrazol-1-yl]ethanol (PubChem CID 146104514) has the molecular formula C12H13BrClN3O and a molecular weight of 330.61 g/mol. Its IUPAC name is 2-[3-[(2-bromo-6-chlorophenyl)methylamino]pyrazol-1-yl]ethanol.
| Compound Name | 2-[3-[(2-bromo-6-chlorophenyl)methylamino]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 146104514 |
| Molecular Formula | C12H13BrClN3O |
| Molecular Weight | 330.61 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 2-[3-[(2-bromo-6-chlorophenyl)methylamino]pyrazol-1-yl]ethanol |
| SMILES | OCCn1ccc(NCc2c(Cl)cccc2Br)n1 |
| InChI | InChI=1S/C12H13BrClN3O/c13-10-2-1-3-11(14)9(10)8-15-12-4-5-17(16-12)6-7-18/h1-5,18H,6-8H2,(H,15,16) |
| InChIKey | OMCVPROMGUGPTB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |