C12H17N5O4 — CID 146105981
methyl (E)-4-[[1-[2-(dimethylamino)-2-oxoethyl]triazole-4-carbonyl]amino]but-2-enoate (PubChem CID 146105981) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is methyl (E)-4-[[1-[2-(dimethylamino)-2-oxoethyl]triazole-4-carbonyl]amino]but-2-enoate.
| Compound Name | methyl (E)-4-[[1-[2-(dimethylamino)-2-oxoethyl]triazole-4-carbonyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 146105981 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | methyl (E)-4-[[1-[2-(dimethylamino)-2-oxoethyl]triazole-4-carbonyl]amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)c1cn(CC(=O)N(C)C)nn1 |
| InChI | InChI=1S/C12H17N5O4/c1-16(2)10(18)8-17-7-9(14-15-17)12(20)13-6-4-5-11(19)21-3/h4-5,7H,6,8H2,1-3H3,(H,13,20)/b5-4+ |
| InChIKey | MAXJOQJZDRXVIG-SNAWJCMRSA-N |
| XLogP | -1.17 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|