C20H31N — CID 14610656
(2Z,4E,8E)-5,9,13-trimethyl-2-propan-2-yltetradeca-2,4,8,12-tetraenenitrile (PubChem CID 14610656) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is (2Z,4E,8E)-5,9,13-trimethyl-2-propan-2-yltetradeca-2,4,8,12-tetraenenitrile.
| Compound Name | (2Z,4E,8E)-5,9,13-trimethyl-2-propan-2-yltetradeca-2,4,8,12-tetraenenitrile |
|---|---|
| PubChem CID | 14610656 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | (2Z,4E,8E)-5,9,13-trimethyl-2-propan-2-yltetradeca-2,4,8,12-tetraenenitrile |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=C(\C#N)C(C)C |
| InChI | InChI=1S/C20H31N/c1-16(2)9-7-10-18(5)11-8-12-19(6)13-14-20(15-21)17(3)4/h9,11,13-14,17H,7-8,10,12H2,1-6H3/b18-11+,19-13+,20-14+ |
| InChIKey | AQROFDJIBGKDOT-PNLWUKOVSA-N |
| XLogP | 6.51 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|