About 3-ethenyl-7-hydroxy-3,7-dimethyloctanal
3-ethenyl-7-hydroxy-3,7-dimethyloctanal (PubChem CID 14610674) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-ethenyl-7-hydroxy-3,7-dimethyloctanal.
Molecular Properties
| Compound Name | 3-ethenyl-7-hydroxy-3,7-dimethyloctanal |
| PubChem CID | 14610674 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 3-ethenyl-7-hydroxy-3,7-dimethyloctanal |
| SMILES | C=CC(C)(CC=O)CCCC(C)(C)O |
| InChI | InChI=1S/C12H22O2/c1-5-12(4,9-10-13)8-6-7-11(2,3)14/h5,10,14H,1,6-9H2,2-4H3 |
| InChIKey | RMSSTDDQDYGBHH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-7-hydroxy-3,7-dimethyloctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-7-hydroxy-3,7-dimethyloctanal?
The IUPAC name of 3-ethenyl-7-hydroxy-3,7-dimethyloctanal (CID 14610674) is 3-ethenyl-7-hydroxy-3,7-dimethyloctanal.
What is the SMILES notation for 3-ethenyl-7-hydroxy-3,7-dimethyloctanal?
The canonical SMILES for 3-ethenyl-7-hydroxy-3,7-dimethyloctanal is C=CC(C)(CC=O)CCCC(C)(C)O.
What is the InChIKey of 3-ethenyl-7-hydroxy-3,7-dimethyloctanal?
The InChIKey is RMSSTDDQDYGBHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-5-12(4,9-10-13)8-6-7-11(2,3)14/h5,10,14H,1,6-9H2,2-4H3.
What are the key properties of 3-ethenyl-7-hydroxy-3,7-dimethyloctanal?
3-ethenyl-7-hydroxy-3,7-dimethyloctanal has a molecular weight of 198.31 g/mol, XLogP of 2.71, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-7-hydroxy-3,7-dimethyloctanal is sourced from PubChem (CID 14610674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).