C15H21NO6S — CID 146107866
3-methoxy-4-[(2,4,5-trimethyloxolan-3-yl)sulfamoyl]benzoic acid (PubChem CID 146107866) has the molecular formula C15H21NO6S and a molecular weight of 343.40 g/mol. Its IUPAC name is 3-methoxy-4-[(2,4,5-trimethyloxolan-3-yl)sulfamoyl]benzoic acid.
| Compound Name | 3-methoxy-4-[(2,4,5-trimethyloxolan-3-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 146107866 |
| Molecular Formula | C15H21NO6S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 3-methoxy-4-[(2,4,5-trimethyloxolan-3-yl)sulfamoyl]benzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1S(=O)(=O)NC1C(C)OC(C)C1C |
| InChI | InChI=1S/C15H21NO6S/c1-8-9(2)22-10(3)14(8)16-23(19,20)13-6-5-11(15(17)18)7-12(13)21-4/h5-10,14,16H,1-4H3,(H,17,18) |
| InChIKey | VJKRUKXVXDKJGL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |