About 2-[6-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]purin-9-yl]propane-1,3-diol
2-[6-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]purin-9-yl]propane-1,3-diol (PubChem CID 146108246) has the molecular formula C15H21N7O2
and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-[6-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]purin-9-yl]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-[6-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]purin-9-yl]propane-1,3-diol |
| PubChem CID | 146108246 |
| Molecular Formula | C15H21N7O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-[6-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]purin-9-yl]propane-1,3-diol |
| SMILES | Cc1c(CN(C)c2ncnc3c2ncn3C(CO)CO)cnn1C |
| InChI | InChI=1S/C15H21N7O2/c1-10-11(4-19-21(10)3)5-20(2)14-13-15(17-8-16-14)22(9-18-13)12(6-23)7-24/h4,8-9,12,23-24H,5-7H2,1-3H3 |
| InChIKey | FXFLCRPQACSFDW-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-[6-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]purin-9-yl]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]purin-9-yl]propane-1,3-diol?
The IUPAC name of 2-[6-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]purin-9-yl]propane-1,3-diol (CID 146108246) is 2-[6-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]purin-9-yl]propane-1,3-diol.
What is the SMILES notation for 2-[6-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]purin-9-yl]propane-1,3-diol?
The canonical SMILES for 2-[6-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]purin-9-yl]propane-1,3-diol is Cc1c(CN(C)c2ncnc3c2ncn3C(CO)CO)cnn1C.
What is the InChIKey of 2-[6-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]purin-9-yl]propane-1,3-diol?
The InChIKey is FXFLCRPQACSFDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N7O2/c1-10-11(4-19-21(10)3)5-20(2)14-13-15(17-8-16-14)22(9-18-13)12(6-23)7-24/h4,8-9,12,23-24H,5-7H2,1-3H3.
What are the key properties of 2-[6-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]purin-9-yl]propane-1,3-diol?
2-[6-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]purin-9-yl]propane-1,3-diol has a molecular weight of 331.38 g/mol, XLogP of 0.03, 6 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[(1,5-dimethylpyrazol-4-yl)methyl-methylamino]purin-9-yl]propane-1,3-diol is sourced from PubChem (CID 146108246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).