C10H16N6O — CID 146109412
(3aR,6aR)-2-(1-methyltetrazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide (PubChem CID 146109412) has the molecular formula C10H16N6O and a molecular weight of 236.28 g/mol. Its IUPAC name is (3aR,6aR)-2-(1-methyltetrazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide.
| Compound Name | (3aR,6aR)-2-(1-methyltetrazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 146109412 |
| Molecular Formula | C10H16N6O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (3aR,6aR)-2-(1-methyltetrazol-5-yl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxamide |
| SMILES | Cn1nnnc1N1C[C@@H]2CCC[C@]2(C(N)=O)C1 |
| InChI | InChI=1S/C10H16N6O/c1-15-9(12-13-14-15)16-5-7-3-2-4-10(7,6-16)8(11)17/h7H,2-6H2,1H3,(H2,11,17)/t7-,10-/m0/s1 |
| InChIKey | YUAAAOMBJPBQMX-XVKPBYJWSA-N |
| XLogP | -0.70 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |