C14H11N7 — CID 146109586
N-[(E)-1H-pyrrol-2-ylmethylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 146109586) has the molecular formula C14H11N7 and a molecular weight of 277.29 g/mol. Its IUPAC name is N-[(E)-1H-pyrrol-2-ylmethylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(E)-1H-pyrrol-2-ylmethylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 146109586 |
| Molecular Formula | C14H11N7 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-[(E)-1H-pyrrol-2-ylmethylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | C(=N/Nc1nnc2c(n1)[nH]c1ccccc12)\c1ccc[nH]1 |
| InChI | InChI=1S/C14H11N7/c1-2-6-11-10(5-1)12-13(17-11)18-14(21-19-12)20-16-8-9-4-3-7-15-9/h1-8,15H,(H2,17,18,20,21)/b16-8+ |
| InChIKey | NTMBAOROVZNHII-LZYBPNLTSA-N |
| XLogP | 2.28 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|