About 4-[(3-methylphenyl)methyl]-1-pentyl-1,2,4-triazol-4-ium chloride
4-[(3-methylphenyl)methyl]-1-pentyl-1,2,4-triazol-4-ium chloride (PubChem CID 146109968) has the molecular formula C15H22ClN3
and a molecular weight of 279.81 g/mol. Its IUPAC name is 4-[(3-methylphenyl)methyl]-1-pentyl-1,2,4-triazol-4-ium chloride.
Molecular Properties
| Compound Name | 4-[(3-methylphenyl)methyl]-1-pentyl-1,2,4-triazol-4-ium chloride |
| PubChem CID | 146109968 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 4-[(3-methylphenyl)methyl]-1-pentyl-1,2,4-triazol-4-ium chloride |
| SMILES | CCCCCn1c[n+](Cc2cccc(C)c2)cn1.[Cl-] |
| InChI | InChI=1S/C15H22N3.ClH/c1-3-4-5-9-18-13-17(12-16-18)11-15-8-6-7-14(2)10-15;/h6-8,10,12-13H,3-5,9,11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | HFLVFLLQPZLSMC-UHFFFAOYSA-M |
| XLogP | -0.28 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-methylphenyl)methyl]-1-pentyl-1,2,4-triazol-4-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-methylphenyl)methyl]-1-pentyl-1,2,4-triazol-4-ium chloride?
The IUPAC name of 4-[(3-methylphenyl)methyl]-1-pentyl-1,2,4-triazol-4-ium chloride (CID 146109968) is 4-[(3-methylphenyl)methyl]-1-pentyl-1,2,4-triazol-4-ium chloride.
What is the SMILES notation for 4-[(3-methylphenyl)methyl]-1-pentyl-1,2,4-triazol-4-ium chloride?
The canonical SMILES for 4-[(3-methylphenyl)methyl]-1-pentyl-1,2,4-triazol-4-ium chloride is CCCCCn1c[n+](Cc2cccc(C)c2)cn1.[Cl-].
What is the InChIKey of 4-[(3-methylphenyl)methyl]-1-pentyl-1,2,4-triazol-4-ium chloride?
The InChIKey is HFLVFLLQPZLSMC-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H22N3.ClH/c1-3-4-5-9-18-13-17(12-16-18)11-15-8-6-7-14(2)10-15;/h6-8,10,12-13H,3-5,9,11H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 4-[(3-methylphenyl)methyl]-1-pentyl-1,2,4-triazol-4-ium chloride?
4-[(3-methylphenyl)methyl]-1-pentyl-1,2,4-triazol-4-ium chloride has a molecular weight of 279.81 g/mol, XLogP of -0.28, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-methylphenyl)methyl]-1-pentyl-1,2,4-triazol-4-ium chloride is sourced from PubChem (CID 146109968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).