C20H23FN4O2 — CID 146110171
2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]acetamide (PubChem CID 146110171) has the molecular formula C20H23FN4O2 and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]acetamide.
| Compound Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]acetamide |
|---|---|
| PubChem CID | 146110171 |
| Molecular Formula | C20H23FN4O2 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[(1R,2R)-2-hydroxy-4-(imidazol-1-ylmethyl)cyclopentyl]acetamide |
| SMILES | Cc1[nH]c2ccc(F)cc2c1CC(=O)N[C@@H]1CC(Cn2ccnc2)C[C@H]1O |
| InChI | InChI=1S/C20H23FN4O2/c1-12-15(16-8-14(21)2-3-17(16)23-12)9-20(27)24-18-6-13(7-19(18)26)10-25-5-4-22-11-25/h2-5,8,11,13,18-19,23,26H,6-7,9-10H2,1H3,(H,24,27)/t13?,18-,19-/m1/s1 |
| InChIKey | KPKXSZSNPSAHRO-GFWLXOEUSA-N |
| XLogP | 2.31 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|