C16H18F3N5O2 — CID 146110945
(5R,7S)-1,5,7-trimethyl-N-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146110945) has the molecular formula C16H18F3N5O2 and a molecular weight of 369.35 g/mol. Its IUPAC name is (5R,7S)-1,5,7-trimethyl-N-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-1,5,7-trimethyl-N-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146110945 |
| Molecular Formula | C16H18F3N5O2 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (5R,7S)-1,5,7-trimethyl-N-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]-5,7-dihydro-4H-pyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(C(=O)NCc3nccc(C(F)(F)F)n3)nn(C)c2[C@H](C)O1 |
| InChI | InChI=1S/C16H18F3N5O2/c1-8-6-10-13(23-24(3)14(10)9(2)26-8)15(25)21-7-12-20-5-4-11(22-12)16(17,18)19/h4-5,8-9H,6-7H2,1-3H3,(H,21,25)/t8-,9+/m1/s1 |
| InChIKey | FRNCQMHVIIAEQN-BDAKNGLRSA-N |
| XLogP | 2.18 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |