C17H18F3N5O2 — CID 146111231
(5R,7S)-5,7-dimethyl-N-[1-[4-(trifluoromethyl)pyrimidin-2-yl]cyclopropyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146111231) has the molecular formula C17H18F3N5O2 and a molecular weight of 381.36 g/mol. Its IUPAC name is (5R,7S)-5,7-dimethyl-N-[1-[4-(trifluoromethyl)pyrimidin-2-yl]cyclopropyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-5,7-dimethyl-N-[1-[4-(trifluoromethyl)pyrimidin-2-yl]cyclopropyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146111231 |
| Molecular Formula | C17H18F3N5O2 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (5R,7S)-5,7-dimethyl-N-[1-[4-(trifluoromethyl)pyrimidin-2-yl]cyclopropyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(C(=O)NC3(c4nccc(C(F)(F)F)n4)CC3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C17H18F3N5O2/c1-8-7-10-12(9(2)27-8)24-25-13(10)14(26)23-16(4-5-16)15-21-6-3-11(22-15)17(18,19)20/h3,6,8-9H,4-5,7H2,1-2H3,(H,23,26)(H,24,25)/t8-,9+/m1/s1 |
| InChIKey | AAKVBXDRXCNCPN-BDAKNGLRSA-N |
| XLogP | 2.66 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |