C15H16F3N5O2 — CID 146111315
(5R,7S)-5,7-dimethyl-N-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146111315) has the molecular formula C15H16F3N5O2 and a molecular weight of 355.32 g/mol. Its IUPAC name is (5R,7S)-5,7-dimethyl-N-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-5,7-dimethyl-N-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146111315 |
| Molecular Formula | C15H16F3N5O2 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (5R,7S)-5,7-dimethyl-N-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(C(=O)NCc3nccc(C(F)(F)F)n3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C15H16F3N5O2/c1-7-5-9-12(8(2)25-7)22-23-13(9)14(24)20-6-11-19-4-3-10(21-11)15(16,17)18/h3-4,7-8H,5-6H2,1-2H3,(H,20,24)(H,22,23)/t7-,8+/m1/s1 |
| InChIKey | VMFMSTSWAVUYIZ-SFYZADRCSA-N |
| XLogP | 2.17 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |