C18H30N4O3 — CID 146111341
[(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(2-methoxyethyl)-2,2-dimethylpiperazin-1-yl]methanone (PubChem CID 146111341) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(2-methoxyethyl)-2,2-dimethylpiperazin-1-yl]methanone.
| Compound Name | [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(2-methoxyethyl)-2,2-dimethylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 146111341 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | [(5S,7R)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[4-(2-methoxyethyl)-2,2-dimethylpiperazin-1-yl]methanone |
| SMILES | COCCN1CCN(C(=O)c2n[nH]c3c2C[C@H](C)O[C@@H]3C)C(C)(C)C1 |
| InChI | InChI=1S/C18H30N4O3/c1-12-10-14-15(13(2)25-12)19-20-16(14)17(23)22-7-6-21(8-9-24-5)11-18(22,3)4/h12-13H,6-11H2,1-5H3,(H,19,20)/t12-,13+/m0/s1 |
| InChIKey | JLTYRJGKGKBYEA-QWHCGFSZSA-N |
| XLogP | 1.61 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |