C14H16F3N5O2 — CID 146111439
(5R,7S)-5,7-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146111439) has the molecular formula C14H16F3N5O2 and a molecular weight of 343.31 g/mol. Its IUPAC name is (5R,7S)-5,7-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-5,7-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146111439 |
| Molecular Formula | C14H16F3N5O2 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (5R,7S)-5,7-dimethyl-N-[[5-(trifluoromethyl)-1H-imidazol-2-yl]methyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(C(=O)NCc3ncc(C(F)(F)F)[nH]3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C14H16F3N5O2/c1-6-3-8-11(7(2)24-6)21-22-12(8)13(23)19-5-10-18-4-9(20-10)14(15,16)17/h4,6-7H,3,5H2,1-2H3,(H,18,20)(H,19,23)(H,21,22)/t6-,7+/m1/s1 |
| InChIKey | AVRNULQLCVMRPW-RQJHMYQMSA-N |
| XLogP | 2.10 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |