C16H18F3N5O2 — CID 146111461
[(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone (PubChem CID 146111461) has the molecular formula C16H18F3N5O2 and a molecular weight of 369.35 g/mol. Its IUPAC name is [(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone.
| Compound Name | [(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 146111461 |
| Molecular Formula | C16H18F3N5O2 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | [(5R,7S)-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazol-3-yl]-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone |
| SMILES | C[C@@H]1Cc2c(C(=O)N3CCn4c(cnc4C(F)(F)F)C3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C16H18F3N5O2/c1-8-5-11-12(9(2)26-8)21-22-13(11)14(25)23-3-4-24-10(7-23)6-20-15(24)16(17,18)19/h6,8-9H,3-5,7H2,1-2H3,(H,21,22)/t8-,9+/m1/s1 |
| InChIKey | HBRIWVHNBUMEQI-BDAKNGLRSA-N |
| XLogP | 2.30 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |