C17H20F3N5O2 — CID 146111479
(5R,7S)-N,5,7-trimethyl-N-[2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146111479) has the molecular formula C17H20F3N5O2 and a molecular weight of 383.37 g/mol. Its IUPAC name is (5R,7S)-N,5,7-trimethyl-N-[2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-N,5,7-trimethyl-N-[2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146111479 |
| Molecular Formula | C17H20F3N5O2 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (5R,7S)-N,5,7-trimethyl-N-[2-[4-(trifluoromethyl)pyrimidin-2-yl]ethyl]-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(C(=O)N(C)CCc3nccc(C(F)(F)F)n3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C17H20F3N5O2/c1-9-8-11-14(10(2)27-9)23-24-15(11)16(26)25(3)7-5-13-21-6-4-12(22-13)17(18,19)20/h4,6,9-10H,5,7-8H2,1-3H3,(H,23,24)/t9-,10+/m1/s1 |
| InChIKey | LNUUJJGYRKAFGS-ZJUUUORDSA-N |
| XLogP | 2.56 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |