About (1E)-N,N,4-trimethylpenta-1,3-dien-1-amine
(1E)-N,N,4-trimethylpenta-1,3-dien-1-amine (PubChem CID 14611150) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is (1E)-N,N,4-trimethylpenta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1E)-N,N,4-trimethylpenta-1,3-dien-1-amine |
| PubChem CID | 14611150 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (1E)-N,N,4-trimethylpenta-1,3-dien-1-amine |
| SMILES | CC(C)=C/C=C/N(C)C |
| InChI | InChI=1S/C8H15N/c1-8(2)6-5-7-9(3)4/h5-7H,1-4H3/b7-5+ |
| InChIKey | AZEDQMIQBQTMOQ-FNORWQNLSA-N |
| XLogP | 2.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-N,N,4-trimethylpenta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-N,N,4-trimethylpenta-1,3-dien-1-amine?
The IUPAC name of (1E)-N,N,4-trimethylpenta-1,3-dien-1-amine (CID 14611150) is (1E)-N,N,4-trimethylpenta-1,3-dien-1-amine.
What is the SMILES notation for (1E)-N,N,4-trimethylpenta-1,3-dien-1-amine?
The canonical SMILES for (1E)-N,N,4-trimethylpenta-1,3-dien-1-amine is CC(C)=C/C=C/N(C)C.
What is the InChIKey of (1E)-N,N,4-trimethylpenta-1,3-dien-1-amine?
The InChIKey is AZEDQMIQBQTMOQ-FNORWQNLSA-N. The full InChI is InChI=1S/C8H15N/c1-8(2)6-5-7-9(3)4/h5-7H,1-4H3/b7-5+.
What are the key properties of (1E)-N,N,4-trimethylpenta-1,3-dien-1-amine?
(1E)-N,N,4-trimethylpenta-1,3-dien-1-amine has a molecular weight of 125.21 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-N,N,4-trimethylpenta-1,3-dien-1-amine is sourced from PubChem (CID 14611150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).