C17H25N3 — CID 14611173
(1S,2S,3R,8aR)-3-(dimethylamino)-5,5,8a-trimethyl-1,2,3,6,7,8-hexahydronaphthalene-1,2-dicarbonitrile (PubChem CID 14611173) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is (1S,2S,3R,8aR)-3-(dimethylamino)-5,5,8a-trimethyl-1,2,3,6,7,8-hexahydronaphthalene-1,2-dicarbonitrile.
| Compound Name | (1S,2S,3R,8aR)-3-(dimethylamino)-5,5,8a-trimethyl-1,2,3,6,7,8-hexahydronaphthalene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 14611173 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | (1S,2S,3R,8aR)-3-(dimethylamino)-5,5,8a-trimethyl-1,2,3,6,7,8-hexahydronaphthalene-1,2-dicarbonitrile |
| SMILES | CN(C)[C@@H]1C=C2C(C)(C)CCC[C@]2(C)[C@@H](C#N)[C@@H]1C#N |
| InChI | InChI=1S/C17H25N3/c1-16(2)7-6-8-17(3)13(11-19)12(10-18)14(20(4)5)9-15(16)17/h9,12-14H,6-8H2,1-5H3/t12-,13-,14+,17+/m0/s1 |
| InChIKey | PBYIOPMKADKGPT-SZOQZIPDSA-N |
| XLogP | 3.35 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|