C14H18O4 — CID 14611178
dimethyl 1,4,5,6,7,8-hexahydronaphthalene-1,2-dicarboxylate (PubChem CID 14611178) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is dimethyl 1,4,5,6,7,8-hexahydronaphthalene-1,2-dicarboxylate.
| Compound Name | dimethyl 1,4,5,6,7,8-hexahydronaphthalene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 14611178 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | dimethyl 1,4,5,6,7,8-hexahydronaphthalene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=CCC2=C(CCCC2)C1C(=O)OC |
| InChI | InChI=1S/C14H18O4/c1-17-13(15)11-8-7-9-5-3-4-6-10(9)12(11)14(16)18-2/h8,12H,3-7H2,1-2H3 |
| InChIKey | DXYSPHMIDFMHOJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|