C18H26N4O — CID 146113142
trans-(1R,2R)-2-[3-(6-methyl-3-pyridinyl)propylamino]-4-(pyrazol-1-ylmethyl)cyclopentan-1-ol (PubChem CID 146113142) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is trans-(1R,2R)-2-[3-(6-methyl-3-pyridinyl)propylamino]-4-(pyrazol-1-ylmethyl)cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-[3-(6-methyl-3-pyridinyl)propylamino]-4-(pyrazol-1-ylmethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 146113142 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | trans-(1R,2R)-2-[3-(6-methyl-3-pyridinyl)propylamino]-4-(pyrazol-1-ylmethyl)cyclopentan-1-ol |
| SMILES | Cc1ccc(CCCN[C@@H]2CC(Cn3cccn3)C[C@H]2O)cn1 |
| InChI | InChI=1S/C18H26N4O/c1-14-5-6-15(12-20-14)4-2-7-19-17-10-16(11-18(17)23)13-22-9-3-8-21-22/h3,5-6,8-9,12,16-19,23H,2,4,7,10-11,13H2,1H3/t16?,17-,18-/m1/s1 |
| InChIKey | TWIACXYJZKGAJI-UKKPGEIXSA-N |
| XLogP | 1.95 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|