C18H20FN5O2 — CID 146113522
N-[(3R,4R)-4-(5-ethyl-1H-1,2,4-triazol-3-yl)oxolan-3-yl]-6-fluoro-3-methyl-1H-indole-2-carboxamide (PubChem CID 146113522) has the molecular formula C18H20FN5O2 and a molecular weight of 357.39 g/mol. Its IUPAC name is N-[(3R,4R)-4-(5-ethyl-1H-1,2,4-triazol-3-yl)oxolan-3-yl]-6-fluoro-3-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[(3R,4R)-4-(5-ethyl-1H-1,2,4-triazol-3-yl)oxolan-3-yl]-6-fluoro-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 146113522 |
| Molecular Formula | C18H20FN5O2 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-[(3R,4R)-4-(5-ethyl-1H-1,2,4-triazol-3-yl)oxolan-3-yl]-6-fluoro-3-methyl-1H-indole-2-carboxamide |
| SMILES | CCc1nc([C@@H]2COC[C@@H]2NC(=O)c2[nH]c3cc(F)ccc3c2C)n[nH]1 |
| InChI | InChI=1S/C18H20FN5O2/c1-3-15-22-17(24-23-15)12-7-26-8-14(12)21-18(25)16-9(2)11-5-4-10(19)6-13(11)20-16/h4-6,12,14,20H,3,7-8H2,1-2H3,(H,21,25)(H,22,23,24)/t12-,14+/m1/s1 |
| InChIKey | ZVVGOVNGVGNBIG-OCCSQVGLSA-N |
| XLogP | 2.21 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|