About 4-[(1,5-dimethylpyrazol-4-yl)methyl]-9-phenylimino-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9-oxide
4-[(1,5-dimethylpyrazol-4-yl)methyl]-9-phenylimino-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9-oxide (PubChem CID 146114303) has the molecular formula C20H28N4O2S
and a molecular weight of 388.54 g/mol. Its IUPAC name is 4-[(1,5-dimethylpyrazol-4-yl)methyl]-9-phenylimino-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9-oxide.
Molecular Properties
| Compound Name | 4-[(1,5-dimethylpyrazol-4-yl)methyl]-9-phenylimino-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9-oxide |
| PubChem CID | 146114303 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 4-[(1,5-dimethylpyrazol-4-yl)methyl]-9-phenylimino-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9-oxide |
| SMILES | Cc1c(CN2CCOC3(CCS(=O)(=Nc4ccccc4)CC3)C2)cnn1C |
| InChI | InChI=1S/C20H28N4O2S/c1-17-18(14-21-23(17)2)15-24-10-11-26-20(16-24)8-12-27(25,13-9-20)22-19-6-4-3-5-7-19/h3-7,14H,8-13,15-16H2,1-2H3 |
| InChIKey | RTYKJENNMHBCTG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(1,5-dimethylpyrazol-4-yl)methyl]-9-phenylimino-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1,5-dimethylpyrazol-4-yl)methyl]-9-phenylimino-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9-oxide?
The IUPAC name of 4-[(1,5-dimethylpyrazol-4-yl)methyl]-9-phenylimino-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9-oxide (CID 146114303) is 4-[(1,5-dimethylpyrazol-4-yl)methyl]-9-phenylimino-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9-oxide.
What is the SMILES notation for 4-[(1,5-dimethylpyrazol-4-yl)methyl]-9-phenylimino-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9-oxide?
The canonical SMILES for 4-[(1,5-dimethylpyrazol-4-yl)methyl]-9-phenylimino-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9-oxide is Cc1c(CN2CCOC3(CCS(=O)(=Nc4ccccc4)CC3)C2)cnn1C.
What is the InChIKey of 4-[(1,5-dimethylpyrazol-4-yl)methyl]-9-phenylimino-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9-oxide?
The InChIKey is RTYKJENNMHBCTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N4O2S/c1-17-18(14-21-23(17)2)15-24-10-11-26-20(16-24)8-12-27(25,13-9-20)22-19-6-4-3-5-7-19/h3-7,14H,8-13,15-16H2,1-2H3.
What are the key properties of 4-[(1,5-dimethylpyrazol-4-yl)methyl]-9-phenylimino-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9-oxide?
4-[(1,5-dimethylpyrazol-4-yl)methyl]-9-phenylimino-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9-oxide has a molecular weight of 388.54 g/mol, XLogP of 2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,5-dimethylpyrazol-4-yl)methyl]-9-phenylimino-1-oxa-9λ6-thia-4-azaspiro[5.5]undecane 9-oxide is sourced from PubChem (CID 146114303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).