C14H20N6O2 — CID 146115146
(5S,7R)-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146115146) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is (5S,7R)-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5S,7R)-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146115146 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (5S,7R)-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | CCn1cnnc1CNC(=O)c1n[nH]c2c1C[C@H](C)O[C@@H]2C |
| InChI | InChI=1S/C14H20N6O2/c1-4-20-7-16-17-11(20)6-15-14(21)13-10-5-8(2)22-9(3)12(10)18-19-13/h7-9H,4-6H2,1-3H3,(H,15,21)(H,18,19)/t8-,9+/m0/s1 |
| InChIKey | UJCBRMXHDGWEKR-DTWKUNHWSA-N |
| XLogP | 0.97 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |