C16H25N3O3 — CID 146115516
(5R,7S)-N-[1-(2-hydroxyethyl)cyclopentyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 146115516) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is (5R,7S)-N-[1-(2-hydroxyethyl)cyclopentyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | (5R,7S)-N-[1-(2-hydroxyethyl)cyclopentyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 146115516 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (5R,7S)-N-[1-(2-hydroxyethyl)cyclopentyl]-5,7-dimethyl-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2c(C(=O)NC3(CCO)CCCC3)n[nH]c2[C@H](C)O1 |
| InChI | InChI=1S/C16H25N3O3/c1-10-9-12-13(11(2)22-10)18-19-14(12)15(21)17-16(7-8-20)5-3-4-6-16/h10-11,20H,3-9H2,1-2H3,(H,17,21)(H,18,19)/t10-,11+/m1/s1 |
| InChIKey | SDHBPRJIOCNMAC-MNOVXSKESA-N |
| XLogP | 1.86 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |