C16H30O3 — CID 146116117
7-(2-methoxypropan-2-yl)-1,4a-dimethyl-3,4,5,6,8,8a-hexahydro-2H-naphthalene-1,7-diol (PubChem CID 146116117) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 7-(2-methoxypropan-2-yl)-1,4a-dimethyl-3,4,5,6,8,8a-hexahydro-2H-naphthalene-1,7-diol.
| Compound Name | 7-(2-methoxypropan-2-yl)-1,4a-dimethyl-3,4,5,6,8,8a-hexahydro-2H-naphthalene-1,7-diol |
|---|---|
| PubChem CID | 146116117 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 7-(2-methoxypropan-2-yl)-1,4a-dimethyl-3,4,5,6,8,8a-hexahydro-2H-naphthalene-1,7-diol |
| SMILES | COC(C)(C)C1(O)CCC2(C)CCCC(C)(O)C2C1 |
| InChI | InChI=1S/C16H30O3/c1-13(2,19-5)16(18)10-9-14(3)7-6-8-15(4,17)12(14)11-16/h12,17-18H,6-11H2,1-5H3 |
| InChIKey | XBBAAWRWXDFEBO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |