About 3-(2-chloro-3,4-dihydroxypentyl)-6,8-dihydroxyisochromen-1-one
3-(2-chloro-3,4-dihydroxypentyl)-6,8-dihydroxyisochromen-1-one (PubChem CID 146116190) has the molecular formula C14H15ClO6
and a molecular weight of 314.72 g/mol. Its IUPAC name is 3-(2-chloro-3,4-dihydroxypentyl)-6,8-dihydroxyisochromen-1-one.
Molecular Properties
| Compound Name | 3-(2-chloro-3,4-dihydroxypentyl)-6,8-dihydroxyisochromen-1-one |
| PubChem CID | 146116190 |
| Molecular Formula | C14H15ClO6 |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 3-(2-chloro-3,4-dihydroxypentyl)-6,8-dihydroxyisochromen-1-one |
| SMILES | CC(O)C(O)C(Cl)Cc1cc2cc(O)cc(O)c2c(=O)o1 |
| InChI | InChI=1S/C14H15ClO6/c1-6(16)13(19)10(15)5-9-3-7-2-8(17)4-11(18)12(7)14(20)21-9/h2-4,6,10,13,16-19H,5H2,1H3 |
| InChIKey | DEGAEGGFINXVTE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-chloro-3,4-dihydroxypentyl)-6,8-dihydroxyisochromen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloro-3,4-dihydroxypentyl)-6,8-dihydroxyisochromen-1-one?
The IUPAC name of 3-(2-chloro-3,4-dihydroxypentyl)-6,8-dihydroxyisochromen-1-one (CID 146116190) is 3-(2-chloro-3,4-dihydroxypentyl)-6,8-dihydroxyisochromen-1-one.
What is the SMILES notation for 3-(2-chloro-3,4-dihydroxypentyl)-6,8-dihydroxyisochromen-1-one?
The canonical SMILES for 3-(2-chloro-3,4-dihydroxypentyl)-6,8-dihydroxyisochromen-1-one is CC(O)C(O)C(Cl)Cc1cc2cc(O)cc(O)c2c(=O)o1.
What is the InChIKey of 3-(2-chloro-3,4-dihydroxypentyl)-6,8-dihydroxyisochromen-1-one?
The InChIKey is DEGAEGGFINXVTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClO6/c1-6(16)13(19)10(15)5-9-3-7-2-8(17)4-11(18)12(7)14(20)21-9/h2-4,6,10,13,16-19H,5H2,1H3.
What are the key properties of 3-(2-chloro-3,4-dihydroxypentyl)-6,8-dihydroxyisochromen-1-one?
3-(2-chloro-3,4-dihydroxypentyl)-6,8-dihydroxyisochromen-1-one has a molecular weight of 314.72 g/mol, XLogP of 1.10, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloro-3,4-dihydroxypentyl)-6,8-dihydroxyisochromen-1-one is sourced from PubChem (CID 146116190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).