C32H47N5O7 — CID 146116544
benzyl (4S,9R,17S)-15-[2-(3,3-dimethylbutanoylamino)ethyl]-2,13,16-trioxo-18-oxa-1,7,12,15-tetrazatricyclo[15.3.1.04,9]henicosane-7-carboxylate (PubChem CID 146116544) has the molecular formula C32H47N5O7 and a molecular weight of 613.76 g/mol. Its IUPAC name is benzyl (4S,9R,17S)-15-[2-(3,3-dimethylbutanoylamino)ethyl]-2,13,16-trioxo-18-oxa-1,7,12,15-tetrazatricyclo[15.3.1.04,9]henicosane-7-carboxylate.
| Compound Name | benzyl (4S,9R,17S)-15-[2-(3,3-dimethylbutanoylamino)ethyl]-2,13,16-trioxo-18-oxa-1,7,12,15-tetrazatricyclo[15.3.1.04,9]henicosane-7-carboxylate |
|---|---|
| PubChem CID | 146116544 |
| Molecular Formula | C32H47N5O7 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.35 |
| IUPAC Name | benzyl (4S,9R,17S)-15-[2-(3,3-dimethylbutanoylamino)ethyl]-2,13,16-trioxo-18-oxa-1,7,12,15-tetrazatricyclo[15.3.1.04,9]henicosane-7-carboxylate |
| SMILES | CC(C)(C)CC(=O)NCCN1CC(=O)NCC[C@H]2CN(C(=O)OCc3ccccc3)CC[C@H]2CC(=O)N2CCO[C@@H](C2)C1=O |
| InChI | InChI=1S/C32H47N5O7/c1-32(2,3)18-27(38)34-12-14-36-21-28(39)33-11-9-25-19-37(31(42)44-22-23-7-5-4-6-8-23)13-10-24(25)17-29(40)35-15-16-43-26(20-35)30(36)41/h4-8,24-26H,9-22H2,1-3H3,(H,33,39)(H,34,38)/t24-,25-,26-/m0/s1 |
| InChIKey | YQZLOQPZJPIJOO-GSDHBNRESA-N |
| XLogP | 1.78 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |