C18H23NO4S — CID 14611683
[1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,8a-hexahydro-2H-cyclohepta[b]pyrrol-6-yl] acetate (PubChem CID 14611683) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is [1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,8a-hexahydro-2H-cyclohepta[b]pyrrol-6-yl] acetate.
| Compound Name | [1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,8a-hexahydro-2H-cyclohepta[b]pyrrol-6-yl] acetate |
|---|---|
| PubChem CID | 14611683 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | [1-(4-methylphenyl)sulfonyl-3,3a,4,5,6,8a-hexahydro-2H-cyclohepta[b]pyrrol-6-yl] acetate |
| SMILES | CC(=O)OC1C=CC2C(CC1)CCN2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H23NO4S/c1-13-3-8-17(9-4-13)24(21,22)19-12-11-15-5-6-16(23-14(2)20)7-10-18(15)19/h3-4,7-10,15-16,18H,5-6,11-12H2,1-2H3 |
| InChIKey | MBKYYHKNZJDRIM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|