C19H23ClN4O5 — CID 146117747
N-[(1R,2S,3R,4R)-4-[(4-cyclopropyltriazol-1-yl)methyl]-2,3-dihydroxycyclopentyl]-1,3-benzodioxole-5-carboxamide;hydrochloride (PubChem CID 146117747) has the molecular formula C19H23ClN4O5 and a molecular weight of 422.87 g/mol. Its IUPAC name is N-[(1R,2S,3R,4R)-4-[(4-cyclopropyltriazol-1-yl)methyl]-2,3-dihydroxycyclopentyl]-1,3-benzodioxole-5-carboxamide;hydrochloride.
| Compound Name | N-[(1R,2S,3R,4R)-4-[(4-cyclopropyltriazol-1-yl)methyl]-2,3-dihydroxycyclopentyl]-1,3-benzodioxole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 146117747 |
| Molecular Formula | C19H23ClN4O5 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-[(1R,2S,3R,4R)-4-[(4-cyclopropyltriazol-1-yl)methyl]-2,3-dihydroxycyclopentyl]-1,3-benzodioxole-5-carboxamide;hydrochloride |
| SMILES | Cl.O=C(N[C@@H]1C[C@H](Cn2cc(C3CC3)nn2)[C@@H](O)[C@H]1O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H22N4O5.ClH/c24-17-12(7-23-8-14(21-22-23)10-1-2-10)5-13(18(17)25)20-19(26)11-3-4-15-16(6-11)28-9-27-15;/h3-4,6,8,10,12-13,17-18,24-25H,1-2,5,7,9H2,(H,20,26);1H/t12-,13-,17-,18+;/m1./s1 |
| InChIKey | ZBKKZDYBMCWHEA-RPUZXPOYSA-N |
| XLogP | 0.85 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |