C18H24Cl2N6O5S — CID 146117784
N-[(1R,2S,3R,4R)-2,3-dihydroxy-4-[(4-pyridin-3-yltriazol-1-yl)methyl]cyclopentyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide;dihydrochloride (PubChem CID 146117784) has the molecular formula C18H24Cl2N6O5S and a molecular weight of 507.40 g/mol. Its IUPAC name is N-[(1R,2S,3R,4R)-2,3-dihydroxy-4-[(4-pyridin-3-yltriazol-1-yl)methyl]cyclopentyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide;dihydrochloride.
| Compound Name | N-[(1R,2S,3R,4R)-2,3-dihydroxy-4-[(4-pyridin-3-yltriazol-1-yl)methyl]cyclopentyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 146117784 |
| Molecular Formula | C18H24Cl2N6O5S |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | N-[(1R,2S,3R,4R)-2,3-dihydroxy-4-[(4-pyridin-3-yltriazol-1-yl)methyl]cyclopentyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide;dihydrochloride |
| SMILES | Cc1noc(C)c1S(=O)(=O)N[C@@H]1C[C@H](Cn2cc(-c3cccnc3)nn2)[C@@H](O)[C@H]1O.Cl.Cl |
| InChI | InChI=1S/C18H22N6O5S.2ClH/c1-10-18(11(2)29-21-10)30(27,28)22-14-6-13(16(25)17(14)26)8-24-9-15(20-23-24)12-4-3-5-19-7-12;;/h3-5,7,9,13-14,16-17,22,25-26H,6,8H2,1-2H3;2*1H/t13-,14-,16-,17+;;/m1../s1 |
| InChIKey | NWYIARZVBJUNAK-DKYMSQABSA-N |
| XLogP | 0.88 |
| TPSA | 156.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |