C17H27Cl2N5O3 — CID 146117792
(1S,2R,3R,5R)-3-[(4-cyclopropyltriazol-1-yl)methyl]-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]cyclopentane-1,2-diol;dihydrochloride (PubChem CID 146117792) has the molecular formula C17H27Cl2N5O3 and a molecular weight of 420.34 g/mol. Its IUPAC name is (1S,2R,3R,5R)-3-[(4-cyclopropyltriazol-1-yl)methyl]-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]cyclopentane-1,2-diol;dihydrochloride.
| Compound Name | (1S,2R,3R,5R)-3-[(4-cyclopropyltriazol-1-yl)methyl]-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]cyclopentane-1,2-diol;dihydrochloride |
|---|---|
| PubChem CID | 146117792 |
| Molecular Formula | C17H27Cl2N5O3 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | (1S,2R,3R,5R)-3-[(4-cyclopropyltriazol-1-yl)methyl]-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]cyclopentane-1,2-diol;dihydrochloride |
| SMILES | Cc1noc(C)c1CN[C@@H]1C[C@H](Cn2cc(C3CC3)nn2)[C@@H](O)[C@H]1O.Cl.Cl |
| InChI | InChI=1S/C17H25N5O3.2ClH/c1-9-13(10(2)25-20-9)6-18-14-5-12(16(23)17(14)24)7-22-8-15(19-21-22)11-3-4-11;;/h8,11-12,14,16-18,23-24H,3-7H2,1-2H3;2*1H/t12-,14-,16-,17+;;/m1../s1 |
| InChIKey | VWBRSNRULNDNCW-GHEKCZNHSA-N |
| XLogP | 1.50 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |