C19H25Cl2N7O4 — CID 146117840
1-[(1R,2S,3R,4R)-2,3-dihydroxy-4-[(4-pyridin-3-yltriazol-1-yl)methyl]cyclopentyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)urea;dihydrochloride (PubChem CID 146117840) has the molecular formula C19H25Cl2N7O4 and a molecular weight of 486.36 g/mol. Its IUPAC name is 1-[(1R,2S,3R,4R)-2,3-dihydroxy-4-[(4-pyridin-3-yltriazol-1-yl)methyl]cyclopentyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)urea;dihydrochloride.
| Compound Name | 1-[(1R,2S,3R,4R)-2,3-dihydroxy-4-[(4-pyridin-3-yltriazol-1-yl)methyl]cyclopentyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)urea;dihydrochloride |
|---|---|
| PubChem CID | 146117840 |
| Molecular Formula | C19H25Cl2N7O4 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 1-[(1R,2S,3R,4R)-2,3-dihydroxy-4-[(4-pyridin-3-yltriazol-1-yl)methyl]cyclopentyl]-3-(3,5-dimethyl-1,2-oxazol-4-yl)urea;dihydrochloride |
| SMILES | Cc1noc(C)c1NC(=O)N[C@@H]1C[C@H](Cn2cc(-c3cccnc3)nn2)[C@@H](O)[C@H]1O.Cl.Cl |
| InChI | InChI=1S/C19H23N7O4.2ClH/c1-10-16(11(2)30-24-10)22-19(29)21-14-6-13(17(27)18(14)28)8-26-9-15(23-25-26)12-4-3-5-20-7-12;;/h3-5,7,9,13-14,17-18,27-28H,6,8H2,1-2H3,(H2,21,22,29);2*1H/t13-,14-,17-,18+;;/m1../s1 |
| InChIKey | GGJGFXMPSOPFEH-VYGUTIKGSA-N |
| XLogP | 1.72 |
| TPSA | 151.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |