About Ethyl, 2-amino-1,1-dimethyl-2-oxo-
Ethyl, 2-amino-1,1-dimethyl-2-oxo- (PubChem CID 14611803) has the molecular formula C4H8NO
and a molecular weight of 86.11 g/mol.
Molecular Properties
| Compound Name | Ethyl, 2-amino-1,1-dimethyl-2-oxo- |
| PubChem CID | 14611803 |
| Molecular Formula | C4H8NO |
| Molecular Weight | 86.11 g/mol |
| Exact Mass | 86.06 |
| IUPAC Name | — |
| SMILES | C[C](C)C(N)=O |
| InChI | InChI=1S/C4H8NO/c1-3(2)4(5)6/h1-2H3,(H2,5,6) |
| InChIKey | WRLSNQXIGKWPGJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.11 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Ethyl, 2-amino-1,1-dimethyl-2-oxo- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethyl, 2-amino-1,1-dimethyl-2-oxo-?
The IUPAC name of Ethyl, 2-amino-1,1-dimethyl-2-oxo- (CID 14611803) is not available.
What is the SMILES notation for Ethyl, 2-amino-1,1-dimethyl-2-oxo-?
The canonical SMILES for Ethyl, 2-amino-1,1-dimethyl-2-oxo- is C[C](C)C(N)=O.
What is the InChIKey of Ethyl, 2-amino-1,1-dimethyl-2-oxo-?
The InChIKey is WRLSNQXIGKWPGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8NO/c1-3(2)4(5)6/h1-2H3,(H2,5,6).
What are the key properties of Ethyl, 2-amino-1,1-dimethyl-2-oxo-?
Ethyl, 2-amino-1,1-dimethyl-2-oxo- has a molecular weight of 86.11 g/mol, XLogP of 0.09, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Ethyl, 2-amino-1,1-dimethyl-2-oxo- is sourced from PubChem (CID 14611803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).