C13H21N3O3 — CID 146119675
(3S,3aS,6aS)-N-cyclopentyl-3-hydroxy-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide (PubChem CID 146119675) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is (3S,3aS,6aS)-N-cyclopentyl-3-hydroxy-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide.
| Compound Name | (3S,3aS,6aS)-N-cyclopentyl-3-hydroxy-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 146119675 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (3S,3aS,6aS)-N-cyclopentyl-3-hydroxy-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide |
| SMILES | CN1C(=O)[C@@H](O)[C@H]2CN(C(=O)NC3CCCC3)C[C@H]21 |
| InChI | InChI=1S/C13H21N3O3/c1-15-10-7-16(6-9(10)11(17)12(15)18)13(19)14-8-4-2-3-5-8/h8-11,17H,2-7H2,1H3,(H,14,19)/t9-,10+,11-/m0/s1 |
| InChIKey | UBAFUMZMUGZHBT-AXFHLTTASA-N |
| XLogP | -0.23 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |