C11H17N3O3 — CID 146119687
(3S,3aS,6aS)-N-cyclopropyl-3-hydroxy-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide (PubChem CID 146119687) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is (3S,3aS,6aS)-N-cyclopropyl-3-hydroxy-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide.
| Compound Name | (3S,3aS,6aS)-N-cyclopropyl-3-hydroxy-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 146119687 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (3S,3aS,6aS)-N-cyclopropyl-3-hydroxy-1-methyl-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide |
| SMILES | CN1C(=O)[C@@H](O)[C@H]2CN(C(=O)NC3CC3)C[C@H]21 |
| InChI | InChI=1S/C11H17N3O3/c1-13-8-5-14(11(17)12-6-2-3-6)4-7(8)9(15)10(13)16/h6-9,15H,2-5H2,1H3,(H,12,17)/t7-,8+,9-/m0/s1 |
| InChIKey | KTLSJBRSDISYEO-YIZRAAEISA-N |
| XLogP | -1.01 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |