C21H20N4O3 — CID 146119749
(3S,3aS,6aS)-1-benzyl-N-(4-cyanophenyl)-3-hydroxy-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide (PubChem CID 146119749) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is (3S,3aS,6aS)-1-benzyl-N-(4-cyanophenyl)-3-hydroxy-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide.
| Compound Name | (3S,3aS,6aS)-1-benzyl-N-(4-cyanophenyl)-3-hydroxy-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 146119749 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (3S,3aS,6aS)-1-benzyl-N-(4-cyanophenyl)-3-hydroxy-2-oxo-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrole-5-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)N2C[C@@H]3[C@H](O)C(=O)N(Cc4ccccc4)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C21H20N4O3/c22-10-14-6-8-16(9-7-14)23-21(28)24-12-17-18(13-24)25(20(27)19(17)26)11-15-4-2-1-3-5-15/h1-9,17-19,26H,11-13H2,(H,23,28)/t17-,18+,19-/m0/s1 |
| InChIKey | NUVDGKQIVSTDSX-OTWHNJEPSA-N |
| XLogP | 1.79 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |