C15H24N2O2 — CID 146119842
(3S,3aS,6aS)-3-(cyclopropylmethoxy)-5-(cyclopropylmethyl)-1-methyl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrol-2-one (PubChem CID 146119842) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (3S,3aS,6aS)-3-(cyclopropylmethoxy)-5-(cyclopropylmethyl)-1-methyl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrol-2-one.
| Compound Name | (3S,3aS,6aS)-3-(cyclopropylmethoxy)-5-(cyclopropylmethyl)-1-methyl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrol-2-one |
|---|---|
| PubChem CID | 146119842 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | (3S,3aS,6aS)-3-(cyclopropylmethoxy)-5-(cyclopropylmethyl)-1-methyl-3a,4,6,6a-tetrahydro-3H-pyrrolo[3,4-b]pyrrol-2-one |
| SMILES | CN1C(=O)[C@@H](OCC2CC2)[C@H]2CN(CC3CC3)C[C@H]21 |
| InChI | InChI=1S/C15H24N2O2/c1-16-13-8-17(6-10-2-3-10)7-12(13)14(15(16)18)19-9-11-4-5-11/h10-14H,2-9H2,1H3/t12-,13+,14-/m0/s1 |
| InChIKey | ZGOKRDWEFDSJOT-MJBXVCDLSA-N |
| XLogP | 0.96 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |